C12H14S3 — CID 19937208
3,5-bis(2,3-dihydrothiophen-2-yl)-2,3-dihydrothiophene (PubChem CID 19937208) has the molecular formula C12H14S3 and a molecular weight of 254.44 g/mol. Its IUPAC name is 3,5-bis(2,3-dihydrothiophen-2-yl)-2,3-dihydrothiophene.
| Compound Name | 3,5-bis(2,3-dihydrothiophen-2-yl)-2,3-dihydrothiophene |
|---|---|
| PubChem CID | 19937208 |
| Molecular Formula | C12H14S3 |
| Molecular Weight | 254.44 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 3,5-bis(2,3-dihydrothiophen-2-yl)-2,3-dihydrothiophene |
| SMILES | C1=CSC(C2=CC(C3CC=CS3)CS2)C1 |
| InChI | InChI=1S/C12H14S3/c1-3-10(13-5-1)9-7-12(15-8-9)11-4-2-6-14-11/h1-2,5-7,9-11H,3-4,8H2 |
| InChIKey | HWQKQRDABBBZGT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |