About 2,3-dimethylbutane-1-thiol
2,3-dimethylbutane-1-thiol (PubChem CID 19937219) has the molecular formula C6H14S
and a molecular weight of 118.25 g/mol. Its IUPAC name is 2,3-dimethylbutane-1-thiol.
Molecular Properties
| Compound Name | 2,3-dimethylbutane-1-thiol |
| PubChem CID | 19937219 |
| Molecular Formula | C6H14S |
| Molecular Weight | 118.25 g/mol |
| Exact Mass | 118.08 |
| IUPAC Name | 2,3-dimethylbutane-1-thiol |
| SMILES | CC(C)C(C)CS |
| InChI | InChI=1S/C6H14S/c1-5(2)6(3)4-7/h5-7H,4H2,1-3H3 |
| InChIKey | JDPIZXUTVCCVGM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethylbutane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylbutane-1-thiol?
The IUPAC name of 2,3-dimethylbutane-1-thiol (CID 19937219) is 2,3-dimethylbutane-1-thiol.
What is the SMILES notation for 2,3-dimethylbutane-1-thiol?
The canonical SMILES for 2,3-dimethylbutane-1-thiol is CC(C)C(C)CS.
What is the InChIKey of 2,3-dimethylbutane-1-thiol?
The InChIKey is JDPIZXUTVCCVGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14S/c1-5(2)6(3)4-7/h5-7H,4H2,1-3H3.
What are the key properties of 2,3-dimethylbutane-1-thiol?
2,3-dimethylbutane-1-thiol has a molecular weight of 118.25 g/mol, XLogP of 2.21, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylbutane-1-thiol is sourced from PubChem (CID 19937219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).