C40H36N2 — CID 19937816
2,3,5,6-tetrakis[(E)-2-(4-methylphenyl)ethenyl]pyrazine (PubChem CID 19937816) has the molecular formula C40H36N2 and a molecular weight of 544.74 g/mol. Its IUPAC name is 2,3,5,6-tetrakis[(E)-2-(4-methylphenyl)ethenyl]pyrazine.
| Compound Name | 2,3,5,6-tetrakis[(E)-2-(4-methylphenyl)ethenyl]pyrazine |
|---|---|
| PubChem CID | 19937816 |
| Molecular Formula | C40H36N2 |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.29 |
| IUPAC Name | 2,3,5,6-tetrakis[(E)-2-(4-methylphenyl)ethenyl]pyrazine |
| SMILES | Cc1ccc(/C=C/c2nc(/C=C/c3ccc(C)cc3)c(/C=C/c3ccc(C)cc3)nc2/C=C/c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C40H36N2/c1-29-5-13-33(14-6-29)21-25-37-38(26-22-34-15-7-30(2)8-16-34)42-40(28-24-36-19-11-32(4)12-20-36)39(41-37)27-23-35-17-9-31(3)10-18-35/h5-28H,1-4H3/b25-21+,26-22+,27-23+,28-24+ |
| InChIKey | INVNOWSCBIQASZ-OBCUGYALSA-N |
| XLogP | 10.39 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |