C29H29NO5 — CID 19938074
N-[2-[bis(4-hydroxyphenyl)methyl]phenyl]-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 19938074) has the molecular formula C29H29NO5 and a molecular weight of 471.55 g/mol. Its IUPAC name is N-[2-[bis(4-hydroxyphenyl)methyl]phenyl]-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | N-[2-[bis(4-hydroxyphenyl)methyl]phenyl]-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 19938074 |
| Molecular Formula | C29H29NO5 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | N-[2-[bis(4-hydroxyphenyl)methyl]phenyl]-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | CC12CCC(C(=O)Nc3ccccc3C(c3ccc(O)cc3)c3ccc(O)cc3)(OC1=O)C2(C)C |
| InChI | InChI=1S/C29H29NO5/c1-27(2)28(3)16-17-29(27,35-26(28)34)25(33)30-23-7-5-4-6-22(23)24(18-8-12-20(31)13-9-18)19-10-14-21(32)15-11-19/h4-15,24,31-32H,16-17H2,1-3H3,(H,30,33) |
| InChIKey | JGKAMNSLOXWFFU-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|