About 7-[[3-(1-methoxyethyl)-1,2-oxazol-5-yl]methoxy]-3,4-dimethylchromene-2-thione
7-[[3-(1-methoxyethyl)-1,2-oxazol-5-yl]methoxy]-3,4-dimethylchromene-2-thione (PubChem CID 19938364) has the molecular formula C18H19NO4S
and a molecular weight of 345.42 g/mol. Its IUPAC name is 7-[[3-(1-methoxyethyl)-1,2-oxazol-5-yl]methoxy]-3,4-dimethylchromene-2-thione.
Molecular Properties
| Compound Name | 7-[[3-(1-methoxyethyl)-1,2-oxazol-5-yl]methoxy]-3,4-dimethylchromene-2-thione |
| PubChem CID | 19938364 |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 7-[[3-(1-methoxyethyl)-1,2-oxazol-5-yl]methoxy]-3,4-dimethylchromene-2-thione |
| SMILES | COC(C)c1cc(COc2ccc3c(C)c(C)c(=S)oc3c2)on1 |
| InChI | InChI=1S/C18H19NO4S/c1-10-11(2)18(24)22-17-8-13(5-6-15(10)17)21-9-14-7-16(19-23-14)12(3)20-4/h5-8,12H,9H2,1-4H3 |
| InChIKey | BGXJGLFRFGTAGJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 57.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 7-[[3-(1-methoxyethyl)-1,2-oxazol-5-yl]methoxy]-3,4-dimethylchromene-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[[3-(1-methoxyethyl)-1,2-oxazol-5-yl]methoxy]-3,4-dimethylchromene-2-thione?
The IUPAC name of 7-[[3-(1-methoxyethyl)-1,2-oxazol-5-yl]methoxy]-3,4-dimethylchromene-2-thione (CID 19938364) is 7-[[3-(1-methoxyethyl)-1,2-oxazol-5-yl]methoxy]-3,4-dimethylchromene-2-thione.
What is the SMILES notation for 7-[[3-(1-methoxyethyl)-1,2-oxazol-5-yl]methoxy]-3,4-dimethylchromene-2-thione?
The canonical SMILES for 7-[[3-(1-methoxyethyl)-1,2-oxazol-5-yl]methoxy]-3,4-dimethylchromene-2-thione is COC(C)c1cc(COc2ccc3c(C)c(C)c(=S)oc3c2)on1.
What is the InChIKey of 7-[[3-(1-methoxyethyl)-1,2-oxazol-5-yl]methoxy]-3,4-dimethylchromene-2-thione?
The InChIKey is BGXJGLFRFGTAGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO4S/c1-10-11(2)18(24)22-17-8-13(5-6-15(10)17)21-9-14-7-16(19-23-14)12(3)20-4/h5-8,12H,9H2,1-4H3.
What are the key properties of 7-[[3-(1-methoxyethyl)-1,2-oxazol-5-yl]methoxy]-3,4-dimethylchromene-2-thione?
7-[[3-(1-methoxyethyl)-1,2-oxazol-5-yl]methoxy]-3,4-dimethylchromene-2-thione has a molecular weight of 345.42 g/mol, XLogP of 5.05, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[[3-(1-methoxyethyl)-1,2-oxazol-5-yl]methoxy]-3,4-dimethylchromene-2-thione is sourced from PubChem (CID 19938364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).