C14H16F3NO3S — CID 19938465
4-phenyl-3-[[3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl]amino]butanoic acid (PubChem CID 19938465) has the molecular formula C14H16F3NO3S and a molecular weight of 335.35 g/mol. Its IUPAC name is 4-phenyl-3-[[3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl]amino]butanoic acid.
| Compound Name | 4-phenyl-3-[[3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 19938465 |
| Molecular Formula | C14H16F3NO3S |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 4-phenyl-3-[[3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl]amino]butanoic acid |
| SMILES | O=C(O)CC(Cc1ccccc1)NC(=O)C(CS)C(F)(F)F |
| InChI | InChI=1S/C14H16F3NO3S/c15-14(16,17)11(8-22)13(21)18-10(7-12(19)20)6-9-4-2-1-3-5-9/h1-5,10-11,22H,6-8H2,(H,18,21)(H,19,20) |
| InChIKey | OWKGDPBRJQGSTN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|