C32H39N5O5S — CID 19939753
butyl N-[2-[4-[[6-(butanoylamino)-7-methyl-2-propylimidazo[4,5-b]pyridin-3-yl]methyl]phenyl]phenyl]sulfonylcarbamate (PubChem CID 19939753) has the molecular formula C32H39N5O5S and a molecular weight of 605.76 g/mol. Its IUPAC name is butyl N-[2-[4-[[6-(butanoylamino)-7-methyl-2-propylimidazo[4,5-b]pyridin-3-yl]methyl]phenyl]phenyl]sulfonylcarbamate.
| Compound Name | butyl N-[2-[4-[[6-(butanoylamino)-7-methyl-2-propylimidazo[4,5-b]pyridin-3-yl]methyl]phenyl]phenyl]sulfonylcarbamate |
|---|---|
| PubChem CID | 19939753 |
| Molecular Formula | C32H39N5O5S |
| Molecular Weight | 605.76 g/mol |
| Exact Mass | 605.27 |
| IUPAC Name | butyl N-[2-[4-[[6-(butanoylamino)-7-methyl-2-propylimidazo[4,5-b]pyridin-3-yl]methyl]phenyl]phenyl]sulfonylcarbamate |
| SMILES | CCCCOC(=O)NS(=O)(=O)c1ccccc1-c1ccc(Cn2c(CCC)nc3c(C)c(NC(=O)CCC)cnc32)cc1 |
| InChI | InChI=1S/C32H39N5O5S/c1-5-8-19-42-32(39)36-43(40,41)27-14-10-9-13-25(27)24-17-15-23(16-18-24)21-37-28(11-6-2)35-30-22(4)26(20-33-31(30)37)34-29(38)12-7-3/h9-10,13-18,20H,5-8,11-12,19,21H2,1-4H3,(H,34,38)(H,36,39) |
| InChIKey | HQFMXUUQMSPIBV-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 132.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.76 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|