C14H10ClFN4O3S — CID 19939915
ethyl 7-chloro-6-fluoro-1-(3-methyl-1,2,4-thiadiazol-5-yl)-4-oxo-1,8-naphthyridine-3-carboxylate (PubChem CID 19939915) has the molecular formula C14H10ClFN4O3S and a molecular weight of 368.78 g/mol. Its IUPAC name is ethyl 7-chloro-6-fluoro-1-(3-methyl-1,2,4-thiadiazol-5-yl)-4-oxo-1,8-naphthyridine-3-carboxylate.
| Compound Name | ethyl 7-chloro-6-fluoro-1-(3-methyl-1,2,4-thiadiazol-5-yl)-4-oxo-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 19939915 |
| Molecular Formula | C14H10ClFN4O3S |
| Molecular Weight | 368.78 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | ethyl 7-chloro-6-fluoro-1-(3-methyl-1,2,4-thiadiazol-5-yl)-4-oxo-1,8-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2nc(C)ns2)c2nc(Cl)c(F)cc2c1=O |
| InChI | InChI=1S/C14H10ClFN4O3S/c1-3-23-13(22)8-5-20(14-17-6(2)19-24-14)12-7(10(8)21)4-9(16)11(15)18-12/h4-5H,3H2,1-2H3 |
| InChIKey | OWKFEZMXXMBWMA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.78 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|