About 12-[tert-butyl(dimethyl)silyl]oxydodeca-5,7-diyn-1-ol
12-[tert-butyl(dimethyl)silyl]oxydodeca-5,7-diyn-1-ol (PubChem CID 19940089) has the molecular formula C18H32O2Si
and a molecular weight of 308.54 g/mol. Its IUPAC name is 12-[tert-butyl(dimethyl)silyl]oxydodeca-5,7-diyn-1-ol.
Molecular Properties
| Compound Name | 12-[tert-butyl(dimethyl)silyl]oxydodeca-5,7-diyn-1-ol |
| PubChem CID | 19940089 |
| Molecular Formula | C18H32O2Si |
| Molecular Weight | 308.54 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | 12-[tert-butyl(dimethyl)silyl]oxydodeca-5,7-diyn-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCC#CC#CCCCCO |
| InChI | InChI=1S/C18H32O2Si/c1-18(2,3)21(4,5)20-17-15-13-11-9-7-6-8-10-12-14-16-19/h19H,10-17H2,1-5H3 |
| InChIKey | AKAITZXYLFNLDZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.54 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 12-[tert-butyl(dimethyl)silyl]oxydodeca-5,7-diyn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-[tert-butyl(dimethyl)silyl]oxydodeca-5,7-diyn-1-ol?
The IUPAC name of 12-[tert-butyl(dimethyl)silyl]oxydodeca-5,7-diyn-1-ol (CID 19940089) is 12-[tert-butyl(dimethyl)silyl]oxydodeca-5,7-diyn-1-ol.
What is the SMILES notation for 12-[tert-butyl(dimethyl)silyl]oxydodeca-5,7-diyn-1-ol?
The canonical SMILES for 12-[tert-butyl(dimethyl)silyl]oxydodeca-5,7-diyn-1-ol is CC(C)(C)[Si](C)(C)OCCCCC#CC#CCCCCO.
What is the InChIKey of 12-[tert-butyl(dimethyl)silyl]oxydodeca-5,7-diyn-1-ol?
The InChIKey is AKAITZXYLFNLDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32O2Si/c1-18(2,3)21(4,5)20-17-15-13-11-9-7-6-8-10-12-14-16-19/h19H,10-17H2,1-5H3.
What are the key properties of 12-[tert-butyl(dimethyl)silyl]oxydodeca-5,7-diyn-1-ol?
12-[tert-butyl(dimethyl)silyl]oxydodeca-5,7-diyn-1-ol has a molecular weight of 308.54 g/mol, XLogP of 4.35, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 12-[tert-butyl(dimethyl)silyl]oxydodeca-5,7-diyn-1-ol is sourced from PubChem (CID 19940089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).