About 2,3,6-trimethylheptane
2,3,6-trimethylheptane (PubChem CID 19944) has the molecular formula C10H22
and a molecular weight of 142.29 g/mol. Its IUPAC name is 2,3,6-trimethylheptane.
Molecular Properties
| Compound Name | 2,3,6-trimethylheptane |
| PubChem CID | 19944 |
| Molecular Formula | C10H22 |
| Molecular Weight | 142.29 g/mol |
| Exact Mass | 142.17 |
| IUPAC Name | 2,3,6-trimethylheptane |
| SMILES | CC(C)CCC(C)C(C)C |
| InChI | InChI=1S/C10H22/c1-8(2)6-7-10(5)9(3)4/h8-10H,6-7H2,1-5H3 |
| InChIKey | IHPXJGBVRWFEJB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.29 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,3,6-trimethylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,6-trimethylheptane?
The IUPAC name of 2,3,6-trimethylheptane (CID 19944) is 2,3,6-trimethylheptane.
What is the SMILES notation for 2,3,6-trimethylheptane?
The canonical SMILES for 2,3,6-trimethylheptane is CC(C)CCC(C)C(C)C.
What is the InChIKey of 2,3,6-trimethylheptane?
The InChIKey is IHPXJGBVRWFEJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22/c1-8(2)6-7-10(5)9(3)4/h8-10H,6-7H2,1-5H3.
What are the key properties of 2,3,6-trimethylheptane?
2,3,6-trimethylheptane has a molecular weight of 142.29 g/mol, XLogP of 3.71, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,6-trimethylheptane is sourced from PubChem (CID 19944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).