C20H25N5O7 — CID 19944846
2-[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]propanoylamino]butanedioic acid (PubChem CID 19944846) has the molecular formula C20H25N5O7 and a molecular weight of 447.45 g/mol. Its IUPAC name is 2-[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]propanoylamino]butanedioic acid.
| Compound Name | 2-[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]propanoylamino]butanedioic acid |
|---|---|
| PubChem CID | 19944846 |
| Molecular Formula | C20H25N5O7 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 2-[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]propanoylamino]butanedioic acid |
| SMILES | CC(NC(=O)CNC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H25N5O7/c1-10(18(29)25-15(20(31)32)7-17(27)28)24-16(26)9-23-19(30)13(21)6-11-8-22-14-5-3-2-4-12(11)14/h2-5,8,10,13,15,22H,6-7,9,21H2,1H3,(H,23,30)(H,24,26)(H,25,29)(H,27,28)(H,31,32) |
| InChIKey | PFHJDXIEAJWDPL-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 203.71 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |