C29H33N7O6S — CID 19945605
2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 19945605) has the molecular formula C29H33N7O6S and a molecular weight of 607.69 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 19945605 |
| Molecular Formula | C29H33N7O6S |
| Molecular Weight | 607.69 g/mol |
| Exact Mass | 607.22 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | NC(Cc1c[nH]c2ccccc12)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C29H33N7O6S/c30-21(10-17-12-32-22-4-2-1-3-20(17)22)26(38)34-24(11-18-13-31-15-33-18)28(40)35-23(9-16-5-7-19(37)8-6-16)27(39)36-25(14-43)29(41)42/h1-8,12-13,15,21,23-25,32,37,43H,9-11,14,30H2,(H,31,33)(H,34,38)(H,35,40)(H,36,39)(H,41,42) |
| InChIKey | PBIFPNUHSXULMU-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 215.32 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.69 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|