C28H42N6O5 — CID 19946326
6-amino-2-[[1-[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoyl]pyrrolidine-2-carbonyl]amino]hexanoic acid (PubChem CID 19946326) has the molecular formula C28H42N6O5 and a molecular weight of 542.68 g/mol. Its IUPAC name is 6-amino-2-[[1-[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoyl]pyrrolidine-2-carbonyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[1-[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoyl]pyrrolidine-2-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 19946326 |
| Molecular Formula | C28H42N6O5 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.32 |
| IUPAC Name | 6-amino-2-[[1-[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoyl]pyrrolidine-2-carbonyl]amino]hexanoic acid |
| SMILES | CC(C)CC(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)N1CCCC1C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C28H42N6O5/c1-17(2)14-23(33-25(35)20(30)15-18-16-31-21-9-4-3-8-19(18)21)27(37)34-13-7-11-24(34)26(36)32-22(28(38)39)10-5-6-12-29/h3-4,8-9,16-17,20,22-24,31H,5-7,10-15,29-30H2,1-2H3,(H,32,36)(H,33,35)(H,38,39) |
| InChIKey | GRAKPEVQOXAFTL-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 183.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|