C27H33N5O6 — CID 19949779
2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoyl]amino]acetyl]amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 19949779) has the molecular formula C27H33N5O6 and a molecular weight of 523.59 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoyl]amino]acetyl]amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoyl]amino]acetyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 19949779 |
| Molecular Formula | C27H33N5O6 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoyl]amino]acetyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | CC(C)C(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NCC(=O)NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C27H33N5O6/c1-15(2)24(32-25(35)20(28)12-17-13-29-21-6-4-3-5-19(17)21)26(36)30-14-23(34)31-22(27(37)38)11-16-7-9-18(33)10-8-16/h3-10,13,15,20,22,24,29,33H,11-12,14,28H2,1-2H3,(H,30,36)(H,31,34)(H,32,35)(H,37,38) |
| InChIKey | CEMMPXBPACNMRL-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 186.64 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |