C29H36N6O7 — CID 19949983
4-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-oxobutanoic acid (PubChem CID 19949983) has the molecular formula C29H36N6O7 and a molecular weight of 580.64 g/mol. Its IUPAC name is 4-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 19949983 |
| Molecular Formula | C29H36N6O7 |
| Molecular Weight | 580.64 g/mol |
| Exact Mass | 580.26 |
| IUPAC Name | 4-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-oxobutanoic acid |
| SMILES | CC(C)C(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C29H36N6O7/c1-15(2)25(35-26(38)20(30)12-17-14-32-21-6-4-3-5-19(17)21)28(40)33-22(11-16-7-9-18(36)10-8-16)27(39)34-23(29(41)42)13-24(31)37/h3-10,14-15,20,22-23,25,32,36H,11-13,30H2,1-2H3,(H2,31,37)(H,33,40)(H,34,39)(H,35,38)(H,41,42) |
| InChIKey | OZOMNRJXHUOKEN-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 229.73 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.64 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |