C21H29N5O9 — CID 19950142
2-[[5-amino-2-[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]-5-oxopentanoyl]amino]butanedioic acid (PubChem CID 19950142) has the molecular formula C21H29N5O9 and a molecular weight of 495.49 g/mol. Its IUPAC name is 2-[[5-amino-2-[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]-5-oxopentanoyl]amino]butanedioic acid.
| Compound Name | 2-[[5-amino-2-[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]-5-oxopentanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 19950142 |
| Molecular Formula | C21H29N5O9 |
| Molecular Weight | 495.49 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | 2-[[5-amino-2-[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]-5-oxopentanoyl]amino]butanedioic acid |
| SMILES | CC(NC(=O)C(N)Cc1ccc(O)cc1)C(=O)NC(CCC(N)=O)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C21H29N5O9/c1-10(24-19(32)13(22)8-11-2-4-12(27)5-3-11)18(31)25-14(6-7-16(23)28)20(33)26-15(21(34)35)9-17(29)30/h2-5,10,13-15,27H,6-9,22H2,1H3,(H2,23,28)(H,24,32)(H,25,31)(H,26,33)(H,29,30)(H,34,35) |
| InChIKey | NSQRFDRCRUMMTM-UHFFFAOYSA-N |
| XLogP | -2.44 |
| TPSA | 251.24 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.49 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |