C30H38N6O7 — CID 19951155
2-[[2-[[4-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-4-oxobutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoic acid (PubChem CID 19951155) has the molecular formula C30H38N6O7 and a molecular weight of 594.67 g/mol. Its IUPAC name is 2-[[2-[[4-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-4-oxobutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[[4-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-4-oxobutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 19951155 |
| Molecular Formula | C30H38N6O7 |
| Molecular Weight | 594.67 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | 2-[[2-[[4-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-4-oxobutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(CC(N)=O)NC(=O)C(N)Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C30H38N6O7/c1-3-16(2)26(30(42)43)36-29(41)23(13-18-15-33-22-7-5-4-6-20(18)22)35-28(40)24(14-25(32)38)34-27(39)21(31)12-17-8-10-19(37)11-9-17/h4-11,15-16,21,23-24,26,33,37H,3,12-14,31H2,1-2H3,(H2,32,38)(H,34,39)(H,35,40)(H,36,41)(H,42,43) |
| InChIKey | IPABDZZZSSSRBG-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 229.73 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.67 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |