C16H19IN2O2 — CID 19955567
2-iodo-1-(5-phenylmethoxyimino-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl)ethanone (PubChem CID 19955567) has the molecular formula C16H19IN2O2 and a molecular weight of 398.24 g/mol. Its IUPAC name is 2-iodo-1-(5-phenylmethoxyimino-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl)ethanone.
| Compound Name | 2-iodo-1-(5-phenylmethoxyimino-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl)ethanone |
|---|---|
| PubChem CID | 19955567 |
| Molecular Formula | C16H19IN2O2 |
| Molecular Weight | 398.24 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 2-iodo-1-(5-phenylmethoxyimino-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl)ethanone |
| SMILES | O=C(CI)N1CC2CC(=NOCc3ccccc3)CC2C1 |
| InChI | InChI=1S/C16H19IN2O2/c17-8-16(20)19-9-13-6-15(7-14(13)10-19)18-21-11-12-4-2-1-3-5-12/h1-5,13-14H,6-11H2 |
| InChIKey | WCIPHUANAHHXLK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.24 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|