About N-(diaminomethylidene)-5,6,8-trimethoxy-2-(2-methylphenyl)quinoline-4-carboxamide
N-(diaminomethylidene)-5,6,8-trimethoxy-2-(2-methylphenyl)quinoline-4-carboxamide (PubChem CID 19955638) has the molecular formula C21H22N4O4
and a molecular weight of 394.43 g/mol. Its IUPAC name is N-(diaminomethylidene)-5,6,8-trimethoxy-2-(2-methylphenyl)quinoline-4-carboxamide.
Molecular Properties
| Compound Name | N-(diaminomethylidene)-5,6,8-trimethoxy-2-(2-methylphenyl)quinoline-4-carboxamide |
| PubChem CID | 19955638 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | N-(diaminomethylidene)-5,6,8-trimethoxy-2-(2-methylphenyl)quinoline-4-carboxamide |
| SMILES | COc1cc(OC)c2nc(-c3ccccc3C)cc(C(=O)N=C(N)N)c2c1OC |
| InChI | InChI=1S/C21H22N4O4/c1-11-7-5-6-8-12(11)14-9-13(20(26)25-21(22)23)17-18(24-14)15(27-2)10-16(28-3)19(17)29-4/h5-10H,1-4H3,(H4,22,23,25,26) |
| InChIKey | SVJHSHFXTLKAIV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 122.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(diaminomethylidene)-5,6,8-trimethoxy-2-(2-methylphenyl)quinoline-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(diaminomethylidene)-5,6,8-trimethoxy-2-(2-methylphenyl)quinoline-4-carboxamide?
The IUPAC name of N-(diaminomethylidene)-5,6,8-trimethoxy-2-(2-methylphenyl)quinoline-4-carboxamide (CID 19955638) is N-(diaminomethylidene)-5,6,8-trimethoxy-2-(2-methylphenyl)quinoline-4-carboxamide.
What is the SMILES notation for N-(diaminomethylidene)-5,6,8-trimethoxy-2-(2-methylphenyl)quinoline-4-carboxamide?
The canonical SMILES for N-(diaminomethylidene)-5,6,8-trimethoxy-2-(2-methylphenyl)quinoline-4-carboxamide is COc1cc(OC)c2nc(-c3ccccc3C)cc(C(=O)N=C(N)N)c2c1OC.
What is the InChIKey of N-(diaminomethylidene)-5,6,8-trimethoxy-2-(2-methylphenyl)quinoline-4-carboxamide?
The InChIKey is SVJHSHFXTLKAIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N4O4/c1-11-7-5-6-8-12(11)14-9-13(20(26)25-21(22)23)17-18(24-14)15(27-2)10-16(28-3)19(17)29-4/h5-10H,1-4H3,(H4,22,23,25,26).
What are the key properties of N-(diaminomethylidene)-5,6,8-trimethoxy-2-(2-methylphenyl)quinoline-4-carboxamide?
N-(diaminomethylidene)-5,6,8-trimethoxy-2-(2-methylphenyl)quinoline-4-carboxamide has a molecular weight of 394.43 g/mol, XLogP of 2.65, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(diaminomethylidene)-5,6,8-trimethoxy-2-(2-methylphenyl)quinoline-4-carboxamide is sourced from PubChem (CID 19955638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).