About 2,4-bis[(3,5-dimethylphenyl)methoxy]-1-phenylcyclohexan-1-amine
2,4-bis[(3,5-dimethylphenyl)methoxy]-1-phenylcyclohexan-1-amine (PubChem CID 19956374) has the molecular formula C30H37NO2
and a molecular weight of 443.63 g/mol. Its IUPAC name is 2,4-bis[(3,5-dimethylphenyl)methoxy]-1-phenylcyclohexan-1-amine.
Molecular Properties
| Compound Name | 2,4-bis[(3,5-dimethylphenyl)methoxy]-1-phenylcyclohexan-1-amine |
| PubChem CID | 19956374 |
| Molecular Formula | C30H37NO2 |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.28 |
| IUPAC Name | 2,4-bis[(3,5-dimethylphenyl)methoxy]-1-phenylcyclohexan-1-amine |
| SMILES | Cc1cc(C)cc(COC2CCC(N)(c3ccccc3)C(OCc3cc(C)cc(C)c3)C2)c1 |
| InChI | InChI=1S/C30H37NO2/c1-21-12-22(2)15-25(14-21)19-32-28-10-11-30(31,27-8-6-5-7-9-27)29(18-28)33-20-26-16-23(3)13-24(4)17-26/h5-9,12-17,28-29H,10-11,18-20,31H2,1-4H3 |
| InChIKey | DLMKQNJBTIEZNT-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-bis[(3,5-dimethylphenyl)methoxy]-1-phenylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-bis[(3,5-dimethylphenyl)methoxy]-1-phenylcyclohexan-1-amine?
The IUPAC name of 2,4-bis[(3,5-dimethylphenyl)methoxy]-1-phenylcyclohexan-1-amine (CID 19956374) is 2,4-bis[(3,5-dimethylphenyl)methoxy]-1-phenylcyclohexan-1-amine.
What is the SMILES notation for 2,4-bis[(3,5-dimethylphenyl)methoxy]-1-phenylcyclohexan-1-amine?
The canonical SMILES for 2,4-bis[(3,5-dimethylphenyl)methoxy]-1-phenylcyclohexan-1-amine is Cc1cc(C)cc(COC2CCC(N)(c3ccccc3)C(OCc3cc(C)cc(C)c3)C2)c1.
What is the InChIKey of 2,4-bis[(3,5-dimethylphenyl)methoxy]-1-phenylcyclohexan-1-amine?
The InChIKey is DLMKQNJBTIEZNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H37NO2/c1-21-12-22(2)15-25(14-21)19-32-28-10-11-30(31,27-8-6-5-7-9-27)29(18-28)33-20-26-16-23(3)13-24(4)17-26/h5-9,12-17,28-29H,10-11,18-20,31H2,1-4H3.
What are the key properties of 2,4-bis[(3,5-dimethylphenyl)methoxy]-1-phenylcyclohexan-1-amine?
2,4-bis[(3,5-dimethylphenyl)methoxy]-1-phenylcyclohexan-1-amine has a molecular weight of 443.63 g/mol, XLogP of 6.43, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-bis[(3,5-dimethylphenyl)methoxy]-1-phenylcyclohexan-1-amine is sourced from PubChem (CID 19956374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).