C16H26O6P2-4 — CID 19956992
dioxido-oxo-[(3E,7E)-4,8,12-trimethyl-1-phosphonatotrideca-3,7,11-trienyl]-λ5-phosphane (PubChem CID 19956992) has the molecular formula C16H26O6P2-4 and a molecular weight of 376.33 g/mol. Its IUPAC name is dioxido-oxo-[(3E,7E)-4,8,12-trimethyl-1-phosphonatotrideca-3,7,11-trienyl]-λ5-phosphane.
| Compound Name | dioxido-oxo-[(3E,7E)-4,8,12-trimethyl-1-phosphonatotrideca-3,7,11-trienyl]-λ5-phosphane |
|---|---|
| PubChem CID | 19956992 |
| Molecular Formula | C16H26O6P2-4 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | dioxido-oxo-[(3E,7E)-4,8,12-trimethyl-1-phosphonatotrideca-3,7,11-trienyl]-λ5-phosphane |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC(P(=O)([O-])[O-])P(=O)([O-])[O-] |
| InChI | InChI=1S/C16H30O6P2/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16(23(17,18)19)24(20,21)22/h7,9,11,16H,5-6,8,10,12H2,1-4H3,(H2,17,18,19)(H2,20,21,22)/p-4/b14-9+,15-11+ |
| InChIKey | QBAOBDKNTDWTHR-YFVJMOTDSA-J |
| XLogP | 1.95 |
| TPSA | 126.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|