About 3-(chloromethyl)-2,5,6-triethyl-4-(2-methoxyethoxy)phenol
3-(chloromethyl)-2,5,6-triethyl-4-(2-methoxyethoxy)phenol (PubChem CID 19957703) has the molecular formula C16H25ClO3
and a molecular weight of 300.83 g/mol. Its IUPAC name is 3-(chloromethyl)-2,5,6-triethyl-4-(2-methoxyethoxy)phenol.
Molecular Properties
| Compound Name | 3-(chloromethyl)-2,5,6-triethyl-4-(2-methoxyethoxy)phenol |
| PubChem CID | 19957703 |
| Molecular Formula | C16H25ClO3 |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 3-(chloromethyl)-2,5,6-triethyl-4-(2-methoxyethoxy)phenol |
| SMILES | CCc1c(O)c(CC)c(CCl)c(OCCOC)c1CC |
| InChI | InChI=1S/C16H25ClO3/c1-5-11-13(7-3)16(20-9-8-19-4)14(10-17)12(6-2)15(11)18/h18H,5-10H2,1-4H3 |
| InChIKey | QYMCDLSFOSUFAJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(chloromethyl)-2,5,6-triethyl-4-(2-methoxyethoxy)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(chloromethyl)-2,5,6-triethyl-4-(2-methoxyethoxy)phenol?
The IUPAC name of 3-(chloromethyl)-2,5,6-triethyl-4-(2-methoxyethoxy)phenol (CID 19957703) is 3-(chloromethyl)-2,5,6-triethyl-4-(2-methoxyethoxy)phenol.
What is the SMILES notation for 3-(chloromethyl)-2,5,6-triethyl-4-(2-methoxyethoxy)phenol?
The canonical SMILES for 3-(chloromethyl)-2,5,6-triethyl-4-(2-methoxyethoxy)phenol is CCc1c(O)c(CC)c(CCl)c(OCCOC)c1CC.
What is the InChIKey of 3-(chloromethyl)-2,5,6-triethyl-4-(2-methoxyethoxy)phenol?
The InChIKey is QYMCDLSFOSUFAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25ClO3/c1-5-11-13(7-3)16(20-9-8-19-4)14(10-17)12(6-2)15(11)18/h18H,5-10H2,1-4H3.
What are the key properties of 3-(chloromethyl)-2,5,6-triethyl-4-(2-methoxyethoxy)phenol?
3-(chloromethyl)-2,5,6-triethyl-4-(2-methoxyethoxy)phenol has a molecular weight of 300.83 g/mol, XLogP of 3.84, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(chloromethyl)-2,5,6-triethyl-4-(2-methoxyethoxy)phenol is sourced from PubChem (CID 19957703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).