C24H50N4 — CID 19957736
3-[6-(1-amino-2,2,6,6-tetramethylpiperidin-3-yl)hexyl]-2,2,6,6-tetramethylpiperidin-1-amine (PubChem CID 19957736) has the molecular formula C24H50N4 and a molecular weight of 394.69 g/mol. Its IUPAC name is 3-[6-(1-amino-2,2,6,6-tetramethylpiperidin-3-yl)hexyl]-2,2,6,6-tetramethylpiperidin-1-amine.
| Compound Name | 3-[6-(1-amino-2,2,6,6-tetramethylpiperidin-3-yl)hexyl]-2,2,6,6-tetramethylpiperidin-1-amine |
|---|---|
| PubChem CID | 19957736 |
| Molecular Formula | C24H50N4 |
| Molecular Weight | 394.69 g/mol |
| Exact Mass | 394.40 |
| IUPAC Name | 3-[6-(1-amino-2,2,6,6-tetramethylpiperidin-3-yl)hexyl]-2,2,6,6-tetramethylpiperidin-1-amine |
| SMILES | CC1(C)CCC(CCCCCCC2CCC(C)(C)N(N)C2(C)C)C(C)(C)N1N |
| InChI | InChI=1S/C24H50N4/c1-21(2)17-15-19(23(5,6)27(21)25)13-11-9-10-12-14-20-16-18-22(3,4)28(26)24(20,7)8/h19-20H,9-18,25-26H2,1-8H3 |
| InChIKey | NCUSTBNOCGOARU-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.69 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|