About 2-methyl-2H-1,3,4-oxadiazol-5-one
2-methyl-2H-1,3,4-oxadiazol-5-one (PubChem CID 19957979) has the molecular formula C3H4N2O2
and a molecular weight of 100.08 g/mol. Its IUPAC name is 2-methyl-2H-1,3,4-oxadiazol-5-one.
Molecular Properties
| Compound Name | 2-methyl-2H-1,3,4-oxadiazol-5-one |
| PubChem CID | 19957979 |
| Molecular Formula | C3H4N2O2 |
| Molecular Weight | 100.08 g/mol |
| Exact Mass | 100.03 |
| IUPAC Name | 2-methyl-2H-1,3,4-oxadiazol-5-one |
| SMILES | CC1N=NC(=O)O1 |
| InChI | InChI=1S/C3H4N2O2/c1-2-4-5-3(6)7-2/h2H,1H3 |
| InChIKey | CKMNHAICUCVZMG-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.08 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-2H-1,3,4-oxadiazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2H-1,3,4-oxadiazol-5-one?
The IUPAC name of 2-methyl-2H-1,3,4-oxadiazol-5-one (CID 19957979) is 2-methyl-2H-1,3,4-oxadiazol-5-one.
What is the SMILES notation for 2-methyl-2H-1,3,4-oxadiazol-5-one?
The canonical SMILES for 2-methyl-2H-1,3,4-oxadiazol-5-one is CC1N=NC(=O)O1.
What is the InChIKey of 2-methyl-2H-1,3,4-oxadiazol-5-one?
The InChIKey is CKMNHAICUCVZMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2O2/c1-2-4-5-3(6)7-2/h2H,1H3.
What are the key properties of 2-methyl-2H-1,3,4-oxadiazol-5-one?
2-methyl-2H-1,3,4-oxadiazol-5-one has a molecular weight of 100.08 g/mol, XLogP of 0.93, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2H-1,3,4-oxadiazol-5-one is sourced from PubChem (CID 19957979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).