C15H20O3 — CID 19958050
6-hydroxy-3-(3-hydroxy-3-methylpent-4-en-1-ynyl)-4,4,6-trimethylcyclohex-2-en-1-one (PubChem CID 19958050) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is 6-hydroxy-3-(3-hydroxy-3-methylpent-4-en-1-ynyl)-4,4,6-trimethylcyclohex-2-en-1-one.
| Compound Name | 6-hydroxy-3-(3-hydroxy-3-methylpent-4-en-1-ynyl)-4,4,6-trimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 19958050 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 6-hydroxy-3-(3-hydroxy-3-methylpent-4-en-1-ynyl)-4,4,6-trimethylcyclohex-2-en-1-one |
| SMILES | C=CC(C)(O)C#CC1=CC(=O)C(C)(O)CC1(C)C |
| InChI | InChI=1S/C15H20O3/c1-6-14(4,17)8-7-11-9-12(16)15(5,18)10-13(11,2)3/h6,9,17-18H,1,10H2,2-5H3 |
| InChIKey | MSCQQJSTGVWPHL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|