About 6-amino-7-bromo-5-(trifluoromethyl)-1,4-dihydroquinoxaline-2,3-dione
6-amino-7-bromo-5-(trifluoromethyl)-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 19958595) has the molecular formula C9H5BrF3N3O2
and a molecular weight of 324.06 g/mol. Its IUPAC name is 6-amino-7-bromo-5-(trifluoromethyl)-1,4-dihydroquinoxaline-2,3-dione.
Molecular Properties
| Compound Name | 6-amino-7-bromo-5-(trifluoromethyl)-1,4-dihydroquinoxaline-2,3-dione |
| PubChem CID | 19958595 |
| Molecular Formula | C9H5BrF3N3O2 |
| Molecular Weight | 324.06 g/mol |
| Exact Mass | 322.95 |
| IUPAC Name | 6-amino-7-bromo-5-(trifluoromethyl)-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | Nc1c(Br)cc2[nH]c(=O)c(=O)[nH]c2c1C(F)(F)F |
| InChI | InChI=1S/C9H5BrF3N3O2/c10-2-1-3-6(16-8(18)7(17)15-3)4(5(2)14)9(11,12)13/h1H,14H2,(H,15,17)(H,16,18) |
| InChIKey | PFJVKCOUPNCWIK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.06 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-7-bromo-5-(trifluoromethyl)-1,4-dihydroquinoxaline-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-7-bromo-5-(trifluoromethyl)-1,4-dihydroquinoxaline-2,3-dione?
The IUPAC name of 6-amino-7-bromo-5-(trifluoromethyl)-1,4-dihydroquinoxaline-2,3-dione (CID 19958595) is 6-amino-7-bromo-5-(trifluoromethyl)-1,4-dihydroquinoxaline-2,3-dione.
What is the SMILES notation for 6-amino-7-bromo-5-(trifluoromethyl)-1,4-dihydroquinoxaline-2,3-dione?
The canonical SMILES for 6-amino-7-bromo-5-(trifluoromethyl)-1,4-dihydroquinoxaline-2,3-dione is Nc1c(Br)cc2[nH]c(=O)c(=O)[nH]c2c1C(F)(F)F.
What is the InChIKey of 6-amino-7-bromo-5-(trifluoromethyl)-1,4-dihydroquinoxaline-2,3-dione?
The InChIKey is PFJVKCOUPNCWIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5BrF3N3O2/c10-2-1-3-6(16-8(18)7(17)15-3)4(5(2)14)9(11,12)13/h1H,14H2,(H,15,17)(H,16,18).
What are the key properties of 6-amino-7-bromo-5-(trifluoromethyl)-1,4-dihydroquinoxaline-2,3-dione?
6-amino-7-bromo-5-(trifluoromethyl)-1,4-dihydroquinoxaline-2,3-dione has a molecular weight of 324.06 g/mol, XLogP of 1.58, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-7-bromo-5-(trifluoromethyl)-1,4-dihydroquinoxaline-2,3-dione is sourced from PubChem (CID 19958595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).