About [5-(methoxymethyl)-1,2-oxazol-3-yl]methanol
[5-(methoxymethyl)-1,2-oxazol-3-yl]methanol (PubChem CID 19958730) has the molecular formula C6H9NO3
and a molecular weight of 143.14 g/mol. Its IUPAC name is [5-(methoxymethyl)-1,2-oxazol-3-yl]methanol.
Molecular Properties
| Compound Name | [5-(methoxymethyl)-1,2-oxazol-3-yl]methanol |
| PubChem CID | 19958730 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | [5-(methoxymethyl)-1,2-oxazol-3-yl]methanol |
| SMILES | COCc1cc(CO)no1 |
| InChI | InChI=1S/C6H9NO3/c1-9-4-6-2-5(3-8)7-10-6/h2,8H,3-4H2,1H3 |
| InChIKey | CTVKFHLSTYWQLY-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(methoxymethyl)-1,2-oxazol-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(methoxymethyl)-1,2-oxazol-3-yl]methanol?
The IUPAC name of [5-(methoxymethyl)-1,2-oxazol-3-yl]methanol (CID 19958730) is [5-(methoxymethyl)-1,2-oxazol-3-yl]methanol.
What is the SMILES notation for [5-(methoxymethyl)-1,2-oxazol-3-yl]methanol?
The canonical SMILES for [5-(methoxymethyl)-1,2-oxazol-3-yl]methanol is COCc1cc(CO)no1.
What is the InChIKey of [5-(methoxymethyl)-1,2-oxazol-3-yl]methanol?
The InChIKey is CTVKFHLSTYWQLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO3/c1-9-4-6-2-5(3-8)7-10-6/h2,8H,3-4H2,1H3.
What are the key properties of [5-(methoxymethyl)-1,2-oxazol-3-yl]methanol?
[5-(methoxymethyl)-1,2-oxazol-3-yl]methanol has a molecular weight of 143.14 g/mol, XLogP of 0.31, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(methoxymethyl)-1,2-oxazol-3-yl]methanol is sourced from PubChem (CID 19958730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).