C16H12O2 — CID 19958800
9-oxotricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene-2-carbaldehyde (PubChem CID 19958800) has the molecular formula C16H12O2 and a molecular weight of 236.27 g/mol. Its IUPAC name is 9-oxotricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene-2-carbaldehyde.
| Compound Name | 9-oxotricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene-2-carbaldehyde |
|---|---|
| PubChem CID | 19958800 |
| Molecular Formula | C16H12O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 9-oxotricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene-2-carbaldehyde |
| SMILES | O=CC1c2ccccc2CC(=O)c2ccccc21 |
| InChI | InChI=1S/C16H12O2/c17-10-15-12-6-2-1-5-11(12)9-16(18)14-8-4-3-7-13(14)15/h1-8,10,15H,9H2 |
| InChIKey | JOQPCVGPAPQBOZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|