C20H19F3N2O4 — CID 19958927
ethyl 4-(3-cyanophenyl)-2-hydroxy-5-oxo-2-(trifluoromethyl)-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate (PubChem CID 19958927) has the molecular formula C20H19F3N2O4 and a molecular weight of 408.38 g/mol. Its IUPAC name is ethyl 4-(3-cyanophenyl)-2-hydroxy-5-oxo-2-(trifluoromethyl)-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate.
| Compound Name | ethyl 4-(3-cyanophenyl)-2-hydroxy-5-oxo-2-(trifluoromethyl)-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 19958927 |
| Molecular Formula | C20H19F3N2O4 |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | ethyl 4-(3-cyanophenyl)-2-hydroxy-5-oxo-2-(trifluoromethyl)-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate |
| SMILES | CCOC(=O)C1C(c2cccc(C#N)c2)C2=C(CCCC2=O)NC1(O)C(F)(F)F |
| InChI | InChI=1S/C20H19F3N2O4/c1-2-29-18(27)17-15(12-6-3-5-11(9-12)10-24)16-13(7-4-8-14(16)26)25-19(17,28)20(21,22)23/h3,5-6,9,15,17,25,28H,2,4,7-8H2,1H3 |
| InChIKey | VKIFMPBKYKVARB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |