C13H13NO2 — CID 19958943
1,4,5,6,7,8-hexahydroacridine-2,3-dione (PubChem CID 19958943) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is 1,4,5,6,7,8-hexahydroacridine-2,3-dione.
| Compound Name | 1,4,5,6,7,8-hexahydroacridine-2,3-dione |
|---|---|
| PubChem CID | 19958943 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 1,4,5,6,7,8-hexahydroacridine-2,3-dione |
| SMILES | O=C1Cc2cc3c(nc2CC1=O)CCCC3 |
| InChI | InChI=1S/C13H13NO2/c15-12-6-9-5-8-3-1-2-4-10(8)14-11(9)7-13(12)16/h5H,1-4,6-7H2 |
| InChIKey | MCPYDVWWIUBNGR-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|