C23H24FN5O4 — CID 19959179
N-[2-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]ethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole-2-carboxamide (PubChem CID 19959179) has the molecular formula C23H24FN5O4 and a molecular weight of 453.47 g/mol. Its IUPAC name is N-[2-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]ethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | N-[2-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]ethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 19959179 |
| Molecular Formula | C23H24FN5O4 |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | N-[2-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]ethyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole-2-carboxamide |
| SMILES | O=C(NCCC1CCN(Cc2ccc(F)cc2)CC1)c1nnc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C23H24FN5O4/c24-19-5-1-17(2-6-19)15-28-13-10-16(11-14-28)9-12-25-21(30)23-27-26-22(33-23)18-3-7-20(8-4-18)29(31)32/h1-8,16H,9-15H2,(H,25,30) |
| InChIKey | XDJSCBQJLOBENN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|