About 1-hexylpyridin-2-one
1-hexylpyridin-2-one (PubChem CID 19959720) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is 1-hexylpyridin-2-one.
Molecular Properties
| Compound Name | 1-hexylpyridin-2-one |
| PubChem CID | 19959720 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 1-hexylpyridin-2-one |
| SMILES | CCCCCCn1ccccc1=O |
| InChI | InChI=1S/C11H17NO/c1-2-3-4-6-9-12-10-7-5-8-11(12)13/h5,7-8,10H,2-4,6,9H2,1H3 |
| InChIKey | IUMAYYKTOYIKBH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-hexylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexylpyridin-2-one?
The IUPAC name of 1-hexylpyridin-2-one (CID 19959720) is 1-hexylpyridin-2-one.
What is the SMILES notation for 1-hexylpyridin-2-one?
The canonical SMILES for 1-hexylpyridin-2-one is CCCCCCn1ccccc1=O.
What is the InChIKey of 1-hexylpyridin-2-one?
The InChIKey is IUMAYYKTOYIKBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO/c1-2-3-4-6-9-12-10-7-5-8-11(12)13/h5,7-8,10H,2-4,6,9H2,1H3.
What are the key properties of 1-hexylpyridin-2-one?
1-hexylpyridin-2-one has a molecular weight of 179.26 g/mol, XLogP of 2.43, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexylpyridin-2-one is sourced from PubChem (CID 19959720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).