About pyrrolo[2,3-c]carbazole
pyrrolo[2,3-c]carbazole (PubChem CID 19960015) has the molecular formula C14H8N2
and a molecular weight of 204.23 g/mol. Its IUPAC name is pyrrolo[2,3-c]carbazole.
Molecular Properties
| Compound Name | pyrrolo[2,3-c]carbazole |
| PubChem CID | 19960015 |
| Molecular Formula | C14H8N2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | pyrrolo[2,3-c]carbazole |
| SMILES | C1=Nc2ccc3c(c2=C1)=c1ccccc1=N3 |
| InChI | InChI=1S/C14H8N2/c1-2-4-12-9(3-1)14-10-7-8-15-11(10)5-6-13(14)16-12/h1-8H |
| InChIKey | XADKHXAULAREPM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze pyrrolo[2,3-c]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolo[2,3-c]carbazole?
The IUPAC name of pyrrolo[2,3-c]carbazole (CID 19960015) is pyrrolo[2,3-c]carbazole.
What is the SMILES notation for pyrrolo[2,3-c]carbazole?
The canonical SMILES for pyrrolo[2,3-c]carbazole is C1=Nc2ccc3c(c2=C1)=c1ccccc1=N3.
What is the InChIKey of pyrrolo[2,3-c]carbazole?
The InChIKey is XADKHXAULAREPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8N2/c1-2-4-12-9(3-1)14-10-7-8-15-11(10)5-6-13(14)16-12/h1-8H.
What are the key properties of pyrrolo[2,3-c]carbazole?
pyrrolo[2,3-c]carbazole has a molecular weight of 204.23 g/mol, XLogP of 1.73, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolo[2,3-c]carbazole is sourced from PubChem (CID 19960015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).