C21H27N5O2 — CID 19960076
2-ethyl-5-[2-(1-hydroxyethyl)piperidin-1-yl]-7-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one (PubChem CID 19960076) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 2-ethyl-5-[2-(1-hydroxyethyl)piperidin-1-yl]-7-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one.
| Compound Name | 2-ethyl-5-[2-(1-hydroxyethyl)piperidin-1-yl]-7-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one |
|---|---|
| PubChem CID | 19960076 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 2-ethyl-5-[2-(1-hydroxyethyl)piperidin-1-yl]-7-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one |
| SMILES | CCN1c2ncccc2C(=O)Nc2c(C)cc(N3CCCCC3C(C)O)nc21 |
| InChI | InChI=1S/C21H27N5O2/c1-4-25-19-15(8-7-10-22-19)21(28)24-18-13(2)12-17(23-20(18)25)26-11-6-5-9-16(26)14(3)27/h7-8,10,12,14,16,27H,4-6,9,11H2,1-3H3,(H,24,28) |
| InChIKey | XHMDPQNWUZADDD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |