C19H20N2S — CID 19960127
3-[5-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)pent-1-ynyl]pyridine (PubChem CID 19960127) has the molecular formula C19H20N2S and a molecular weight of 308.45 g/mol. Its IUPAC name is 3-[5-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)pent-1-ynyl]pyridine.
| Compound Name | 3-[5-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)pent-1-ynyl]pyridine |
|---|---|
| PubChem CID | 19960127 |
| Molecular Formula | C19H20N2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 3-[5-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)pent-1-ynyl]pyridine |
| SMILES | C(#Cc1cccnc1)CCCN1CC=C(c2cccs2)CC1 |
| InChI | InChI=1S/C19H20N2S/c1(2-6-17-7-4-11-20-16-17)3-12-21-13-9-18(10-14-21)19-8-5-15-22-19/h4-5,7-9,11,15-16H,1,3,10,12-14H2 |
| InChIKey | LKEOSUBECMJXII-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|