About butyl 4-[[3,5-bis(trifluoromethyl)benzoyl]oxymethyl]-4-phenylpiperidine-1-carboxylate
butyl 4-[[3,5-bis(trifluoromethyl)benzoyl]oxymethyl]-4-phenylpiperidine-1-carboxylate (PubChem CID 19960179) has the molecular formula C26H27F6NO4
and a molecular weight of 531.49 g/mol. Its IUPAC name is butyl 4-[[3,5-bis(trifluoromethyl)benzoyl]oxymethyl]-4-phenylpiperidine-1-carboxylate.
Molecular Properties
| Compound Name | butyl 4-[[3,5-bis(trifluoromethyl)benzoyl]oxymethyl]-4-phenylpiperidine-1-carboxylate |
| PubChem CID | 19960179 |
| Molecular Formula | C26H27F6NO4 |
| Molecular Weight | 531.49 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | butyl 4-[[3,5-bis(trifluoromethyl)benzoyl]oxymethyl]-4-phenylpiperidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCC(COC(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H27F6NO4/c1-2-3-13-36-23(35)33-11-9-24(10-12-33,19-7-5-4-6-8-19)17-37-22(34)18-14-20(25(27,28)29)16-21(15-18)26(30,31)32/h4-8,14-16H,2-3,9-13,17H2,1H3 |
| InChIKey | IMHAZIMXIMYPJN-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 531.49 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 4-[[3,5-bis(trifluoromethyl)benzoyl]oxymethyl]-4-phenylpiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 4-[[3,5-bis(trifluoromethyl)benzoyl]oxymethyl]-4-phenylpiperidine-1-carboxylate?
The IUPAC name of butyl 4-[[3,5-bis(trifluoromethyl)benzoyl]oxymethyl]-4-phenylpiperidine-1-carboxylate (CID 19960179) is butyl 4-[[3,5-bis(trifluoromethyl)benzoyl]oxymethyl]-4-phenylpiperidine-1-carboxylate.
What is the SMILES notation for butyl 4-[[3,5-bis(trifluoromethyl)benzoyl]oxymethyl]-4-phenylpiperidine-1-carboxylate?
The canonical SMILES for butyl 4-[[3,5-bis(trifluoromethyl)benzoyl]oxymethyl]-4-phenylpiperidine-1-carboxylate is CCCCOC(=O)N1CCC(COC(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2ccccc2)CC1.
What is the InChIKey of butyl 4-[[3,5-bis(trifluoromethyl)benzoyl]oxymethyl]-4-phenylpiperidine-1-carboxylate?
The InChIKey is IMHAZIMXIMYPJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H27F6NO4/c1-2-3-13-36-23(35)33-11-9-24(10-12-33,19-7-5-4-6-8-19)17-37-22(34)18-14-20(25(27,28)29)16-21(15-18)26(30,31)32/h4-8,14-16H,2-3,9-13,17H2,1H3.
What are the key properties of butyl 4-[[3,5-bis(trifluoromethyl)benzoyl]oxymethyl]-4-phenylpiperidine-1-carboxylate?
butyl 4-[[3,5-bis(trifluoromethyl)benzoyl]oxymethyl]-4-phenylpiperidine-1-carboxylate has a molecular weight of 531.49 g/mol, XLogP of 6.85, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 4-[[3,5-bis(trifluoromethyl)benzoyl]oxymethyl]-4-phenylpiperidine-1-carboxylate is sourced from PubChem (CID 19960179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).