C13H10FNO4 — CID 19960336
4-[(4-fluorophenyl)methoxy]-3-hydroxypyridine-2-carboxylic acid (PubChem CID 19960336) has the molecular formula C13H10FNO4 and a molecular weight of 263.22 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)methoxy]-3-hydroxypyridine-2-carboxylic acid.
| Compound Name | 4-[(4-fluorophenyl)methoxy]-3-hydroxypyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 19960336 |
| Molecular Formula | C13H10FNO4 |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 4-[(4-fluorophenyl)methoxy]-3-hydroxypyridine-2-carboxylic acid |
| SMILES | O=C(O)c1nccc(OCc2ccc(F)cc2)c1O |
| InChI | InChI=1S/C13H10FNO4/c14-9-3-1-8(2-4-9)7-19-10-5-6-15-11(12(10)16)13(17)18/h1-6,16H,7H2,(H,17,18) |
| InChIKey | LNNWQWLELKJWKO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |