C12H14N2 — CID 19960712
4,5-dimethylidene-1,4a-dihydronaphthalene-1,8-diamine (PubChem CID 19960712) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 4,5-dimethylidene-1,4a-dihydronaphthalene-1,8-diamine.
| Compound Name | 4,5-dimethylidene-1,4a-dihydronaphthalene-1,8-diamine |
|---|---|
| PubChem CID | 19960712 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 4,5-dimethylidene-1,4a-dihydronaphthalene-1,8-diamine |
| SMILES | C=C1C=CC(N)=C2C(N)C=CC(=C)C12 |
| InChI | InChI=1S/C12H14N2/c1-7-3-5-9(13)12-10(14)6-4-8(2)11(7)12/h3-6,9,11H,1-2,13-14H2 |
| InChIKey | NHLBSFQIWQYNFO-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |