C24H41BrN2O5Si2 — CID 19960787
ethyl 2-bromo-2-[8-oxo-1,7-bis(2-trimethylsilylethoxymethyl)-6H-pyrrolo[2,3-c]azepin-4-yl]acetate (PubChem CID 19960787) has the molecular formula C24H41BrN2O5Si2 and a molecular weight of 573.68 g/mol. Its IUPAC name is ethyl 2-bromo-2-[8-oxo-1,7-bis(2-trimethylsilylethoxymethyl)-6H-pyrrolo[2,3-c]azepin-4-yl]acetate.
| Compound Name | ethyl 2-bromo-2-[8-oxo-1,7-bis(2-trimethylsilylethoxymethyl)-6H-pyrrolo[2,3-c]azepin-4-yl]acetate |
|---|---|
| PubChem CID | 19960787 |
| Molecular Formula | C24H41BrN2O5Si2 |
| Molecular Weight | 573.68 g/mol |
| Exact Mass | 572.17 |
| IUPAC Name | ethyl 2-bromo-2-[8-oxo-1,7-bis(2-trimethylsilylethoxymethyl)-6H-pyrrolo[2,3-c]azepin-4-yl]acetate |
| SMILES | CCOC(=O)C(Br)C1=CCN(COCC[Si](C)(C)C)C(=O)c2c1ccn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C24H41BrN2O5Si2/c1-8-32-24(29)21(25)19-9-12-27(18-31-14-16-34(5,6)7)23(28)22-20(19)10-11-26(22)17-30-13-15-33(2,3)4/h9-11,21H,8,12-18H2,1-7H3 |
| InChIKey | VWGAYJUFBXXLJA-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 70.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.68 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|