C11H13NS — CID 19960942
3,3a,4,5-tetrahydro-2H-thieno[3,2-d]quinoline (PubChem CID 19960942) has the molecular formula C11H13NS and a molecular weight of 191.30 g/mol. Its IUPAC name is 3,3a,4,5-tetrahydro-2H-thieno[3,2-d]quinoline.
| Compound Name | 3,3a,4,5-tetrahydro-2H-thieno[3,2-d]quinoline |
|---|---|
| PubChem CID | 19960942 |
| Molecular Formula | C11H13NS |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 3,3a,4,5-tetrahydro-2H-thieno[3,2-d]quinoline |
| SMILES | C1=CC2=NCCC3CCSC23C=C1 |
| InChI | InChI=1S/C11H13NS/c1-2-6-11-9(5-8-13-11)4-7-12-10(11)3-1/h1-3,6,9H,4-5,7-8H2 |
| InChIKey | ZWMDFNZWHGSPFI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |