C9H18N2O — CID 19960995
1-(1,3,4,5,6,6a-hexahydrofuro[3,4-c]pyrrol-3a-yl)-N,N-dimethylmethanamine (PubChem CID 19960995) has the molecular formula C9H18N2O and a molecular weight of 170.26 g/mol. Its IUPAC name is 1-(1,3,4,5,6,6a-hexahydrofuro[3,4-c]pyrrol-3a-yl)-N,N-dimethylmethanamine.
| Compound Name | 1-(1,3,4,5,6,6a-hexahydrofuro[3,4-c]pyrrol-3a-yl)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 19960995 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | 1-(1,3,4,5,6,6a-hexahydrofuro[3,4-c]pyrrol-3a-yl)-N,N-dimethylmethanamine |
| SMILES | CN(C)CC12CNCC1COC2 |
| InChI | InChI=1S/C9H18N2O/c1-11(2)6-9-5-10-3-8(9)4-12-7-9/h8,10H,3-7H2,1-2H3 |
| InChIKey | HSSMURRIIYHIMX-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |