C13H6Cl2F8O2 — CID 19961364
1-(3,5-dichlorophenyl)-4,4,6,6,6-pentafluoro-5-(trifluoromethyl)hexane-1,3-dione (PubChem CID 19961364) has the molecular formula C13H6Cl2F8O2 and a molecular weight of 417.08 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-4,4,6,6,6-pentafluoro-5-(trifluoromethyl)hexane-1,3-dione.
| Compound Name | 1-(3,5-dichlorophenyl)-4,4,6,6,6-pentafluoro-5-(trifluoromethyl)hexane-1,3-dione |
|---|---|
| PubChem CID | 19961364 |
| Molecular Formula | C13H6Cl2F8O2 |
| Molecular Weight | 417.08 g/mol |
| Exact Mass | 415.96 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-4,4,6,6,6-pentafluoro-5-(trifluoromethyl)hexane-1,3-dione |
| SMILES | O=C(CC(=O)C(F)(F)C(C(F)(F)F)C(F)(F)F)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H6Cl2F8O2/c14-6-1-5(2-7(15)3-6)8(24)4-9(25)11(16,17)10(12(18,19)20)13(21,22)23/h1-3,10H,4H2 |
| InChIKey | AMZSVPAHDRJTLG-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.08 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|