C13H5BrF10O2 — CID 19961376
1-(3-bromo-5-fluorophenyl)-4,4,5,6,6,6-hexafluoro-5-(trifluoromethyl)hexane-1,3-dione (PubChem CID 19961376) has the molecular formula C13H5BrF10O2 and a molecular weight of 463.07 g/mol. Its IUPAC name is 1-(3-bromo-5-fluorophenyl)-4,4,5,6,6,6-hexafluoro-5-(trifluoromethyl)hexane-1,3-dione.
| Compound Name | 1-(3-bromo-5-fluorophenyl)-4,4,5,6,6,6-hexafluoro-5-(trifluoromethyl)hexane-1,3-dione |
|---|---|
| PubChem CID | 19961376 |
| Molecular Formula | C13H5BrF10O2 |
| Molecular Weight | 463.07 g/mol |
| Exact Mass | 461.93 |
| IUPAC Name | 1-(3-bromo-5-fluorophenyl)-4,4,5,6,6,6-hexafluoro-5-(trifluoromethyl)hexane-1,3-dione |
| SMILES | O=C(CC(=O)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F)c1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C13H5BrF10O2/c14-6-1-5(2-7(15)3-6)8(25)4-9(26)10(16,17)11(18,12(19,20)21)13(22,23)24/h1-3H,4H2 |
| InChIKey | SBVHMZYSSJKXQC-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.07 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|