About 1,4-diethylnaphthalene-2,3-dicarboxylic acid
1,4-diethylnaphthalene-2,3-dicarboxylic acid (PubChem CID 19961477) has the molecular formula C16H16O4
and a molecular weight of 272.30 g/mol. Its IUPAC name is 1,4-diethylnaphthalene-2,3-dicarboxylic acid.
Molecular Properties
| Compound Name | 1,4-diethylnaphthalene-2,3-dicarboxylic acid |
| PubChem CID | 19961477 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 1,4-diethylnaphthalene-2,3-dicarboxylic acid |
| SMILES | CCc1c(C(=O)O)c(C(=O)O)c(CC)c2ccccc12 |
| InChI | InChI=1S/C16H16O4/c1-3-9-11-7-5-6-8-12(11)10(4-2)14(16(19)20)13(9)15(17)18/h5-8H,3-4H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | QAQQHCCCOMRLKB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4-diethylnaphthalene-2,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diethylnaphthalene-2,3-dicarboxylic acid?
The IUPAC name of 1,4-diethylnaphthalene-2,3-dicarboxylic acid (CID 19961477) is 1,4-diethylnaphthalene-2,3-dicarboxylic acid.
What is the SMILES notation for 1,4-diethylnaphthalene-2,3-dicarboxylic acid?
The canonical SMILES for 1,4-diethylnaphthalene-2,3-dicarboxylic acid is CCc1c(C(=O)O)c(C(=O)O)c(CC)c2ccccc12.
What is the InChIKey of 1,4-diethylnaphthalene-2,3-dicarboxylic acid?
The InChIKey is QAQQHCCCOMRLKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O4/c1-3-9-11-7-5-6-8-12(11)10(4-2)14(16(19)20)13(9)15(17)18/h5-8H,3-4H2,1-2H3,(H,17,18)(H,19,20).
What are the key properties of 1,4-diethylnaphthalene-2,3-dicarboxylic acid?
1,4-diethylnaphthalene-2,3-dicarboxylic acid has a molecular weight of 272.30 g/mol, XLogP of 3.36, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diethylnaphthalene-2,3-dicarboxylic acid is sourced from PubChem (CID 19961477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).