About 2-imidazol-1-ylbutanoic acid
2-imidazol-1-ylbutanoic acid (PubChem CID 19961525) has the molecular formula C7H10N2O2
and a molecular weight of 154.17 g/mol. Its IUPAC name is 2-imidazol-1-ylbutanoic acid.
Molecular Properties
| Compound Name | 2-imidazol-1-ylbutanoic acid |
| PubChem CID | 19961525 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 2-imidazol-1-ylbutanoic acid |
| SMILES | CCC(C(=O)O)n1ccnc1 |
| InChI | InChI=1S/C7H10N2O2/c1-2-6(7(10)11)9-4-3-8-5-9/h3-6H,2H2,1H3,(H,10,11) |
| InChIKey | RYIFBESXYBFFFR-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-imidazol-1-ylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imidazol-1-ylbutanoic acid?
The IUPAC name of 2-imidazol-1-ylbutanoic acid (CID 19961525) is 2-imidazol-1-ylbutanoic acid.
What is the SMILES notation for 2-imidazol-1-ylbutanoic acid?
The canonical SMILES for 2-imidazol-1-ylbutanoic acid is CCC(C(=O)O)n1ccnc1.
What is the InChIKey of 2-imidazol-1-ylbutanoic acid?
The InChIKey is RYIFBESXYBFFFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2/c1-2-6(7(10)11)9-4-3-8-5-9/h3-6H,2H2,1H3,(H,10,11).
What are the key properties of 2-imidazol-1-ylbutanoic acid?
2-imidazol-1-ylbutanoic acid has a molecular weight of 154.17 g/mol, XLogP of 0.92, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imidazol-1-ylbutanoic acid is sourced from PubChem (CID 19961525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).