C8H11FN3O6PS — CID 19962064
[5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl dihydrogen phosphate (PubChem CID 19962064) has the molecular formula C8H11FN3O6PS and a molecular weight of 327.23 g/mol. Its IUPAC name is [5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 19962064 |
| Molecular Formula | C8H11FN3O6PS |
| Molecular Weight | 327.23 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | [5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl dihydrogen phosphate |
| SMILES | Nc1nc(=O)n(C2CSC(COP(=O)(O)O)O2)cc1F |
| InChI | InChI=1S/C8H11FN3O6PS/c9-4-1-12(8(13)11-7(4)10)5-3-20-6(18-5)2-17-19(14,15)16/h1,5-6H,2-3H2,(H2,10,11,13)(H2,14,15,16) |
| InChIKey | WQOMZMVXTRGMHZ-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 136.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.23 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|