About 3-hydroxy-1,1-bis(2-hydroxyethyl)pyrrolidin-1-ium-2,5-dione
3-hydroxy-1,1-bis(2-hydroxyethyl)pyrrolidin-1-ium-2,5-dione (PubChem CID 19962227) has the molecular formula C8H14NO5+
and a molecular weight of 204.20 g/mol. Its IUPAC name is 3-hydroxy-1,1-bis(2-hydroxyethyl)pyrrolidin-1-ium-2,5-dione.
Molecular Properties
| Compound Name | 3-hydroxy-1,1-bis(2-hydroxyethyl)pyrrolidin-1-ium-2,5-dione |
| PubChem CID | 19962227 |
| Molecular Formula | C8H14NO5+ |
| Molecular Weight | 204.20 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 3-hydroxy-1,1-bis(2-hydroxyethyl)pyrrolidin-1-ium-2,5-dione |
| SMILES | O=C1CC(O)C(=O)[N+]1(CCO)CCO |
| InChI | InChI=1S/C8H14NO5/c10-3-1-9(2-4-11)7(13)5-6(12)8(9)14/h6,10-12H,1-5H2/q+1 |
| InChIKey | JSMJCEJXSJQCTJ-UHFFFAOYSA-N |
| XLogP | -2.39 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.20 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-1,1-bis(2-hydroxyethyl)pyrrolidin-1-ium-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-1,1-bis(2-hydroxyethyl)pyrrolidin-1-ium-2,5-dione?
The IUPAC name of 3-hydroxy-1,1-bis(2-hydroxyethyl)pyrrolidin-1-ium-2,5-dione (CID 19962227) is 3-hydroxy-1,1-bis(2-hydroxyethyl)pyrrolidin-1-ium-2,5-dione.
What is the SMILES notation for 3-hydroxy-1,1-bis(2-hydroxyethyl)pyrrolidin-1-ium-2,5-dione?
The canonical SMILES for 3-hydroxy-1,1-bis(2-hydroxyethyl)pyrrolidin-1-ium-2,5-dione is O=C1CC(O)C(=O)[N+]1(CCO)CCO.
What is the InChIKey of 3-hydroxy-1,1-bis(2-hydroxyethyl)pyrrolidin-1-ium-2,5-dione?
The InChIKey is JSMJCEJXSJQCTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14NO5/c10-3-1-9(2-4-11)7(13)5-6(12)8(9)14/h6,10-12H,1-5H2/q+1.
What are the key properties of 3-hydroxy-1,1-bis(2-hydroxyethyl)pyrrolidin-1-ium-2,5-dione?
3-hydroxy-1,1-bis(2-hydroxyethyl)pyrrolidin-1-ium-2,5-dione has a molecular weight of 204.20 g/mol, XLogP of -2.39, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-1,1-bis(2-hydroxyethyl)pyrrolidin-1-ium-2,5-dione is sourced from PubChem (CID 19962227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).