About 2-methyl-1,2,3,4-tetrahydrotetracene
2-methyl-1,2,3,4-tetrahydrotetracene (PubChem CID 19962649) has the molecular formula C19H18
and a molecular weight of 246.35 g/mol. Its IUPAC name is 2-methyl-1,2,3,4-tetrahydrotetracene.
Molecular Properties
| Compound Name | 2-methyl-1,2,3,4-tetrahydrotetracene |
| PubChem CID | 19962649 |
| Molecular Formula | C19H18 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 2-methyl-1,2,3,4-tetrahydrotetracene |
| SMILES | CC1CCc2cc3cc4ccccc4cc3cc2C1 |
| InChI | InChI=1S/C19H18/c1-13-6-7-16-11-18-9-14-4-2-3-5-15(14)10-19(18)12-17(16)8-13/h2-5,9-13H,6-8H2,1H3 |
| InChIKey | JHYDJRQCNHKEBN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1,2,3,4-tetrahydrotetracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,2,3,4-tetrahydrotetracene?
The IUPAC name of 2-methyl-1,2,3,4-tetrahydrotetracene (CID 19962649) is 2-methyl-1,2,3,4-tetrahydrotetracene.
What is the SMILES notation for 2-methyl-1,2,3,4-tetrahydrotetracene?
The canonical SMILES for 2-methyl-1,2,3,4-tetrahydrotetracene is CC1CCc2cc3cc4ccccc4cc3cc2C1.
What is the InChIKey of 2-methyl-1,2,3,4-tetrahydrotetracene?
The InChIKey is JHYDJRQCNHKEBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18/c1-13-6-7-16-11-18-9-14-4-2-3-5-15(14)10-19(18)12-17(16)8-13/h2-5,9-13H,6-8H2,1H3.
What are the key properties of 2-methyl-1,2,3,4-tetrahydrotetracene?
2-methyl-1,2,3,4-tetrahydrotetracene has a molecular weight of 246.35 g/mol, XLogP of 5.12, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,2,3,4-tetrahydrotetracene is sourced from PubChem (CID 19962649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).