C10H19F5O3Si — CID 19963837
triethoxy(3,3,4,4,4-pentafluorobutyl)silane (PubChem CID 19963837) has the molecular formula C10H19F5O3Si and a molecular weight of 310.34 g/mol. Its IUPAC name is triethoxy(3,3,4,4,4-pentafluorobutyl)silane.
| Compound Name | triethoxy(3,3,4,4,4-pentafluorobutyl)silane |
|---|---|
| PubChem CID | 19963837 |
| Molecular Formula | C10H19F5O3Si |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | triethoxy(3,3,4,4,4-pentafluorobutyl)silane |
| SMILES | CCO[Si](CCC(F)(F)C(F)(F)F)(OCC)OCC |
| InChI | InChI=1S/C10H19F5O3Si/c1-4-16-19(17-5-2,18-6-3)8-7-9(11,12)10(13,14)15/h4-8H2,1-3H3 |
| InChIKey | CZZDWWIZZYZQIL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|