About triethoxy-[3,3,3-trifluoro-2-(trifluoromethyl)propyl]silane
triethoxy-[3,3,3-trifluoro-2-(trifluoromethyl)propyl]silane (PubChem CID 19963852) has the molecular formula C10H18F6O3Si
and a molecular weight of 328.33 g/mol. Its IUPAC name is triethoxy-[3,3,3-trifluoro-2-(trifluoromethyl)propyl]silane.
Molecular Properties
| Compound Name | triethoxy-[3,3,3-trifluoro-2-(trifluoromethyl)propyl]silane |
| PubChem CID | 19963852 |
| Molecular Formula | C10H18F6O3Si |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | triethoxy-[3,3,3-trifluoro-2-(trifluoromethyl)propyl]silane |
| SMILES | CCO[Si](CC(C(F)(F)F)C(F)(F)F)(OCC)OCC |
| InChI | InChI=1S/C10H18F6O3Si/c1-4-17-20(18-5-2,19-6-3)7-8(9(11,12)13)10(14,15)16/h8H,4-7H2,1-3H3 |
| InChIKey | SJQNLKQIEGNTMW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triethoxy-[3,3,3-trifluoro-2-(trifluoromethyl)propyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethoxy-[3,3,3-trifluoro-2-(trifluoromethyl)propyl]silane?
The IUPAC name of triethoxy-[3,3,3-trifluoro-2-(trifluoromethyl)propyl]silane (CID 19963852) is triethoxy-[3,3,3-trifluoro-2-(trifluoromethyl)propyl]silane.
What is the SMILES notation for triethoxy-[3,3,3-trifluoro-2-(trifluoromethyl)propyl]silane?
The canonical SMILES for triethoxy-[3,3,3-trifluoro-2-(trifluoromethyl)propyl]silane is CCO[Si](CC(C(F)(F)F)C(F)(F)F)(OCC)OCC.
What is the InChIKey of triethoxy-[3,3,3-trifluoro-2-(trifluoromethyl)propyl]silane?
The InChIKey is SJQNLKQIEGNTMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F6O3Si/c1-4-17-20(18-5-2,19-6-3)7-8(9(11,12)13)10(14,15)16/h8H,4-7H2,1-3H3.
What are the key properties of triethoxy-[3,3,3-trifluoro-2-(trifluoromethyl)propyl]silane?
triethoxy-[3,3,3-trifluoro-2-(trifluoromethyl)propyl]silane has a molecular weight of 328.33 g/mol, XLogP of 3.78, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for triethoxy-[3,3,3-trifluoro-2-(trifluoromethyl)propyl]silane is sourced from PubChem (CID 19963852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).